| // Copyright 2016 Google Inc. All rights reserved. |
| // |
| // Licensed under the Apache License, Version 2.0 (the "License"); |
| // you may not use this file except in compliance with the License. |
| // You may obtain a copy of the License at |
| // |
| // http://www.apache.org/licenses/LICENSE-2.0 |
| // |
| // Unless required by applicable law or agreed to in writing, software |
| // distributed under the License is distributed on an "AS IS" BASIS, |
| // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. |
| // See the License for the specific language governing permissions and |
| // limitations under the License. |
| |
| package etc |
| |
| // This file implements module types that install prebuilt artifacts. |
| // |
| // There exist two classes of prebuilt modules in the Android tree. The first class are the ones |
| // based on `android.Prebuilt`, such as `cc_prebuilt_library` and `java_import`. This kind of |
| // modules may exist both as prebuilts and source at the same time, though only one would be |
| // installed and the other would be marked disabled. The `prebuilt_postdeps` mutator would select |
| // the actual modules to be installed. More details in android/prebuilt.go. |
| // |
| // The second class is described in this file. Unlike `android.Prebuilt` based module types, |
| // `prebuilt_etc` exist only as prebuilts and cannot have a same-named source module counterpart. |
| // This makes the logic of `prebuilt_etc` to be much simpler as they don't need to go through the |
| // various `prebuilt_*` mutators. |
| |
| import ( |
| "encoding/json" |
| "fmt" |
| "path/filepath" |
| "reflect" |
| "strings" |
| |
| "github.com/google/blueprint/proptools" |
| |
| "android/soong/android" |
| "android/soong/bazel" |
| "android/soong/bazel/cquery" |
| "android/soong/snapshot" |
| "android/soong/ui/metrics/bp2build_metrics_proto" |
| ) |
| |
| var pctx = android.NewPackageContext("android/soong/etc") |
| |
| // TODO(jungw): Now that it handles more than the ones in etc/, consider renaming this file. |
| |
| func init() { |
| pctx.Import("android/soong/android") |
| RegisterPrebuiltEtcBuildComponents(android.InitRegistrationContext) |
| snapshot.RegisterSnapshotAction(generatePrebuiltSnapshot) |
| } |
| |
| func RegisterPrebuiltEtcBuildComponents(ctx android.RegistrationContext) { |
| ctx.RegisterModuleType("prebuilt_etc", PrebuiltEtcFactory) |
| ctx.RegisterModuleType("prebuilt_etc_host", PrebuiltEtcHostFactory) |
| ctx.RegisterModuleType("prebuilt_etc_cacerts", PrebuiltEtcCaCertsFactory) |
| ctx.RegisterModuleType("prebuilt_root", PrebuiltRootFactory) |
| ctx.RegisterModuleType("prebuilt_root_host", PrebuiltRootHostFactory) |
| ctx.RegisterModuleType("prebuilt_usr_share", PrebuiltUserShareFactory) |
| ctx.RegisterModuleType("prebuilt_usr_share_host", PrebuiltUserShareHostFactory) |
| ctx.RegisterModuleType("prebuilt_font", PrebuiltFontFactory) |
| ctx.RegisterModuleType("prebuilt_firmware", PrebuiltFirmwareFactory) |
| ctx.RegisterModuleType("prebuilt_dsp", PrebuiltDSPFactory) |
| ctx.RegisterModuleType("prebuilt_rfsa", PrebuiltRFSAFactory) |
| ctx.RegisterModuleType("prebuilt_renderscript_bitcode", PrebuiltRenderScriptBitcodeFactory) |
| |
| ctx.RegisterModuleType("prebuilt_defaults", defaultsFactory) |
| |
| } |
| |
| var PrepareForTestWithPrebuiltEtc = android.FixtureRegisterWithContext(RegisterPrebuiltEtcBuildComponents) |
| |
| type prebuiltEtcProperties struct { |
| // Source file of this prebuilt. Can reference a genrule type module with the ":module" syntax. |
| Src *string `android:"path,arch_variant"` |
| |
| // Optional name for the installed file. If unspecified, name of the module is used as the file |
| // name. |
| Filename *string `android:"arch_variant"` |
| |
| // When set to true, and filename property is not set, the name for the installed file |
| // is the same as the file name of the source file. |
| Filename_from_src *bool `android:"arch_variant"` |
| |
| // Make this module available when building for ramdisk. |
| // On device without a dedicated recovery partition, the module is only |
| // available after switching root into |
| // /first_stage_ramdisk. To expose the module before switching root, install |
| // the recovery variant instead. |
| Ramdisk_available *bool |
| |
| // Make this module available when building for vendor ramdisk. |
| // On device without a dedicated recovery partition, the module is only |
| // available after switching root into |
| // /first_stage_ramdisk. To expose the module before switching root, install |
| // the recovery variant instead. |
| Vendor_ramdisk_available *bool |
| |
| // Make this module available when building for debug ramdisk. |
| Debug_ramdisk_available *bool |
| |
| // Make this module available when building for recovery. |
| Recovery_available *bool |
| |
| // Whether this module is directly installable to one of the partitions. Default: true. |
| Installable *bool |
| |
| // Install symlinks to the installed file. |
| Symlinks []string `android:"arch_variant"` |
| } |
| |
| type prebuiltSubdirProperties struct { |
| // Optional subdirectory under which this file is installed into, cannot be specified with |
| // relative_install_path, prefer relative_install_path. |
| Sub_dir *string `android:"arch_variant"` |
| |
| // Optional subdirectory under which this file is installed into, cannot be specified with |
| // sub_dir. |
| Relative_install_path *string `android:"arch_variant"` |
| } |
| |
| type PrebuiltEtcModule interface { |
| android.Module |
| |
| // Returns the base install directory, such as "etc", "usr/share". |
| BaseDir() string |
| |
| // Returns the sub install directory relative to BaseDir(). |
| SubDir() string |
| |
| // Returns an android.OutputPath to the intermeidate file, which is the renamed prebuilt source |
| // file. |
| OutputFile() android.OutputPath |
| } |
| |
| type PrebuiltEtc struct { |
| android.ModuleBase |
| android.DefaultableModuleBase |
| android.BazelModuleBase |
| |
| snapshot.VendorSnapshotModuleInterface |
| snapshot.RecoverySnapshotModuleInterface |
| |
| properties prebuiltEtcProperties |
| subdirProperties prebuiltSubdirProperties |
| |
| sourceFilePath android.Path |
| outputFilePath android.OutputPath |
| // The base install location, e.g. "etc" for prebuilt_etc, "usr/share" for prebuilt_usr_share. |
| installDirBase string |
| installDirBase64 string |
| installAvoidMultilibConflict bool |
| // The base install location when soc_specific property is set to true, e.g. "firmware" for |
| // prebuilt_firmware. |
| socInstallDirBase string |
| installDirPath android.InstallPath |
| additionalDependencies *android.Paths |
| |
| makeClass string |
| } |
| |
| type Defaults struct { |
| android.ModuleBase |
| android.DefaultsModuleBase |
| } |
| |
| func (p *PrebuiltEtc) inRamdisk() bool { |
| return p.ModuleBase.InRamdisk() || p.ModuleBase.InstallInRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) onlyInRamdisk() bool { |
| return p.ModuleBase.InstallInRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) InstallInRamdisk() bool { |
| return p.inRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) inVendorRamdisk() bool { |
| return p.ModuleBase.InVendorRamdisk() || p.ModuleBase.InstallInVendorRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) onlyInVendorRamdisk() bool { |
| return p.ModuleBase.InstallInVendorRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) InstallInVendorRamdisk() bool { |
| return p.inVendorRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) inDebugRamdisk() bool { |
| return p.ModuleBase.InDebugRamdisk() || p.ModuleBase.InstallInDebugRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) onlyInDebugRamdisk() bool { |
| return p.ModuleBase.InstallInDebugRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) InstallInDebugRamdisk() bool { |
| return p.inDebugRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) InRecovery() bool { |
| return p.ModuleBase.InRecovery() || p.ModuleBase.InstallInRecovery() |
| } |
| |
| func (p *PrebuiltEtc) onlyInRecovery() bool { |
| return p.ModuleBase.InstallInRecovery() |
| } |
| |
| func (p *PrebuiltEtc) InstallInRecovery() bool { |
| return p.InRecovery() |
| } |
| |
| var _ android.ImageInterface = (*PrebuiltEtc)(nil) |
| |
| func (p *PrebuiltEtc) ImageMutatorBegin(ctx android.BaseModuleContext) {} |
| |
| func (p *PrebuiltEtc) CoreVariantNeeded(ctx android.BaseModuleContext) bool { |
| return !p.ModuleBase.InstallInRecovery() && !p.ModuleBase.InstallInRamdisk() && |
| !p.ModuleBase.InstallInVendorRamdisk() && !p.ModuleBase.InstallInDebugRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) RamdiskVariantNeeded(ctx android.BaseModuleContext) bool { |
| return proptools.Bool(p.properties.Ramdisk_available) || p.ModuleBase.InstallInRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) VendorRamdiskVariantNeeded(ctx android.BaseModuleContext) bool { |
| return proptools.Bool(p.properties.Vendor_ramdisk_available) || p.ModuleBase.InstallInVendorRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) DebugRamdiskVariantNeeded(ctx android.BaseModuleContext) bool { |
| return proptools.Bool(p.properties.Debug_ramdisk_available) || p.ModuleBase.InstallInDebugRamdisk() |
| } |
| |
| func (p *PrebuiltEtc) RecoveryVariantNeeded(ctx android.BaseModuleContext) bool { |
| return proptools.Bool(p.properties.Recovery_available) || p.ModuleBase.InstallInRecovery() |
| } |
| |
| func (p *PrebuiltEtc) ExtraImageVariations(ctx android.BaseModuleContext) []string { |
| return nil |
| } |
| |
| func (p *PrebuiltEtc) SetImageVariation(ctx android.BaseModuleContext, variation string, module android.Module) { |
| } |
| |
| func (p *PrebuiltEtc) SourceFilePath(ctx android.ModuleContext) android.Path { |
| return android.PathForModuleSrc(ctx, proptools.String(p.properties.Src)) |
| } |
| |
| func (p *PrebuiltEtc) InstallDirPath() android.InstallPath { |
| return p.installDirPath |
| } |
| |
| // This allows other derivative modules (e.g. prebuilt_etc_xml) to perform |
| // additional steps (like validating the src) before the file is installed. |
| func (p *PrebuiltEtc) SetAdditionalDependencies(paths android.Paths) { |
| p.additionalDependencies = &paths |
| } |
| |
| func (p *PrebuiltEtc) OutputFile() android.OutputPath { |
| return p.outputFilePath |
| } |
| |
| var _ android.OutputFileProducer = (*PrebuiltEtc)(nil) |
| |
| func (p *PrebuiltEtc) OutputFiles(tag string) (android.Paths, error) { |
| switch tag { |
| case "": |
| return android.Paths{p.outputFilePath}, nil |
| default: |
| return nil, fmt.Errorf("unsupported module reference tag %q", tag) |
| } |
| } |
| |
| func (p *PrebuiltEtc) SubDir() string { |
| if subDir := proptools.String(p.subdirProperties.Sub_dir); subDir != "" { |
| return subDir |
| } |
| return proptools.String(p.subdirProperties.Relative_install_path) |
| } |
| |
| func (p *PrebuiltEtc) BaseDir() string { |
| return p.installDirBase |
| } |
| |
| func (p *PrebuiltEtc) Installable() bool { |
| return p.properties.Installable == nil || proptools.Bool(p.properties.Installable) |
| } |
| |
| func (p *PrebuiltEtc) InVendor() bool { |
| return p.ModuleBase.InstallInVendor() |
| } |
| |
| func (p *PrebuiltEtc) ExcludeFromVendorSnapshot() bool { |
| return false |
| } |
| |
| func (p *PrebuiltEtc) ExcludeFromRecoverySnapshot() bool { |
| return false |
| } |
| |
| func (p *PrebuiltEtc) GenerateAndroidBuildActions(ctx android.ModuleContext) { |
| filename := proptools.String(p.properties.Filename) |
| filenameFromSrc := proptools.Bool(p.properties.Filename_from_src) |
| if p.properties.Src != nil { |
| p.sourceFilePath = android.PathForModuleSrc(ctx, proptools.String(p.properties.Src)) |
| |
| // Determine the output file basename. |
| // If Filename is set, use the name specified by the property. |
| // If Filename_from_src is set, use the source file name. |
| // Otherwise use the module name. |
| if filename != "" { |
| if filenameFromSrc { |
| ctx.PropertyErrorf("filename_from_src", "filename is set. filename_from_src can't be true") |
| return |
| } |
| } else if filenameFromSrc { |
| filename = p.sourceFilePath.Base() |
| } else { |
| filename = ctx.ModuleName() |
| } |
| } else if ctx.Config().AllowMissingDependencies() { |
| // If no srcs was set and AllowMissingDependencies is enabled then |
| // mark the module as missing dependencies and set a fake source path |
| // and file name. |
| ctx.AddMissingDependencies([]string{"MISSING_PREBUILT_SRC_FILE"}) |
| p.sourceFilePath = android.PathForModuleSrc(ctx) |
| if filename == "" { |
| filename = ctx.ModuleName() |
| } |
| } else { |
| ctx.PropertyErrorf("src", "missing prebuilt source file") |
| return |
| } |
| |
| if strings.Contains(filename, "/") { |
| ctx.PropertyErrorf("filename", "filename cannot contain separator '/'") |
| return |
| } |
| |
| // Check that `sub_dir` and `relative_install_path` are not set at the same time. |
| if p.subdirProperties.Sub_dir != nil && p.subdirProperties.Relative_install_path != nil { |
| ctx.PropertyErrorf("sub_dir", "relative_install_path is set. Cannot set sub_dir") |
| } |
| |
| // If soc install dir was specified and SOC specific is set, set the installDirPath to the |
| // specified socInstallDirBase. |
| installBaseDir := p.installDirBase |
| if p.Target().Arch.ArchType.Multilib == "lib64" && p.installDirBase64 != "" { |
| installBaseDir = p.installDirBase64 |
| } |
| if p.SocSpecific() && p.socInstallDirBase != "" { |
| installBaseDir = p.socInstallDirBase |
| } |
| if p.installAvoidMultilibConflict && !ctx.Host() && ctx.Config().HasMultilibConflict(ctx.Arch().ArchType) { |
| installBaseDir = filepath.Join(installBaseDir, ctx.Arch().ArchType.String()) |
| } |
| |
| p.installDirPath = android.PathForModuleInstall(ctx, installBaseDir, p.SubDir()) |
| |
| // Call InstallFile even when uninstallable to make the module included in the package |
| ip := installProperties{ |
| installable: p.Installable(), |
| filename: filename, |
| sourceFilePath: p.sourceFilePath, |
| symlinks: p.properties.Symlinks, |
| } |
| p.addInstallRules(ctx, ip) |
| } |
| |
| type installProperties struct { |
| installable bool |
| filename string |
| sourceFilePath android.Path |
| symlinks []string |
| } |
| |
| // utility function to add install rules to the build graph. |
| // Reduces code duplication between Soong and Mixed build analysis |
| func (p *PrebuiltEtc) addInstallRules(ctx android.ModuleContext, ip installProperties) { |
| if !ip.installable { |
| p.SkipInstall() |
| } |
| |
| // Copy the file from src to a location in out/ with the correct `filename` |
| // This ensures that outputFilePath has the correct name for others to |
| // use, as the source file may have a different name. |
| p.outputFilePath = android.PathForModuleOut(ctx, ip.filename).OutputPath |
| ctx.Build(pctx, android.BuildParams{ |
| Rule: android.Cp, |
| Output: p.outputFilePath, |
| Input: ip.sourceFilePath, |
| }) |
| |
| installPath := ctx.InstallFile(p.installDirPath, ip.filename, p.outputFilePath) |
| for _, sl := range ip.symlinks { |
| ctx.InstallSymlink(p.installDirPath, sl, installPath) |
| } |
| } |
| |
| func (p *PrebuiltEtc) AndroidMkEntries() []android.AndroidMkEntries { |
| nameSuffix := "" |
| if p.inRamdisk() && !p.onlyInRamdisk() { |
| nameSuffix = ".ramdisk" |
| } |
| if p.inVendorRamdisk() && !p.onlyInVendorRamdisk() { |
| nameSuffix = ".vendor_ramdisk" |
| } |
| if p.inDebugRamdisk() && !p.onlyInDebugRamdisk() { |
| nameSuffix = ".debug_ramdisk" |
| } |
| if p.InRecovery() && !p.onlyInRecovery() { |
| nameSuffix = ".recovery" |
| } |
| |
| class := p.makeClass |
| if class == "" { |
| class = "ETC" |
| } |
| |
| return []android.AndroidMkEntries{android.AndroidMkEntries{ |
| Class: class, |
| SubName: nameSuffix, |
| OutputFile: android.OptionalPathForPath(p.outputFilePath), |
| ExtraEntries: []android.AndroidMkExtraEntriesFunc{ |
| func(ctx android.AndroidMkExtraEntriesContext, entries *android.AndroidMkEntries) { |
| entries.SetString("LOCAL_MODULE_TAGS", "optional") |
| entries.SetString("LOCAL_MODULE_PATH", p.installDirPath.String()) |
| entries.SetString("LOCAL_INSTALLED_MODULE_STEM", p.outputFilePath.Base()) |
| if len(p.properties.Symlinks) > 0 { |
| entries.AddStrings("LOCAL_MODULE_SYMLINKS", p.properties.Symlinks...) |
| } |
| entries.SetBoolIfTrue("LOCAL_UNINSTALLABLE_MODULE", !p.Installable()) |
| if p.additionalDependencies != nil { |
| entries.AddStrings("LOCAL_ADDITIONAL_DEPENDENCIES", p.additionalDependencies.Strings()...) |
| } |
| }, |
| }, |
| }} |
| } |
| |
| func InitPrebuiltEtcModule(p *PrebuiltEtc, dirBase string) { |
| p.installDirBase = dirBase |
| p.AddProperties(&p.properties) |
| p.AddProperties(&p.subdirProperties) |
| } |
| |
| func InitPrebuiltRootModule(p *PrebuiltEtc) { |
| p.installDirBase = "." |
| p.AddProperties(&p.properties) |
| } |
| |
| // prebuilt_etc is for a prebuilt artifact that is installed in |
| // <partition>/etc/<sub_dir> directory. |
| func PrebuiltEtcFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "etc") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| android.InitBazelModule(module) |
| return module |
| } |
| |
| func defaultsFactory() android.Module { |
| return DefaultsFactory() |
| } |
| |
| func DefaultsFactory(props ...interface{}) android.Module { |
| module := &Defaults{} |
| |
| module.AddProperties(props...) |
| module.AddProperties( |
| &prebuiltEtcProperties{}, |
| &prebuiltSubdirProperties{}, |
| ) |
| |
| android.InitDefaultsModule(module) |
| |
| return module |
| } |
| |
| // prebuilt_etc_host is for a host prebuilt artifact that is installed in |
| // $(HOST_OUT)/etc/<sub_dir> directory. |
| func PrebuiltEtcHostFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "etc") |
| // This module is host-only |
| android.InitAndroidArchModule(module, android.HostSupported, android.MultilibCommon) |
| android.InitDefaultableModule(module) |
| android.InitBazelModule(module) |
| return module |
| } |
| |
| // prebuilt_etc_host is for a host prebuilt artifact that is installed in |
| // <partition>/etc/<sub_dir> directory. |
| func PrebuiltEtcCaCertsFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "cacerts") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitBazelModule(module) |
| return module |
| } |
| |
| // prebuilt_root is for a prebuilt artifact that is installed in |
| // <partition>/ directory. Can't have any sub directories. |
| func PrebuiltRootFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltRootModule(module) |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_root_host is for a host prebuilt artifact that is installed in $(HOST_OUT)/<sub_dir> |
| // directory. |
| func PrebuiltRootHostFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, ".") |
| // This module is host-only |
| android.InitAndroidArchModule(module, android.HostSupported, android.MultilibCommon) |
| android.InitDefaultableModule(module) |
| android.InitBazelModule(module) |
| return module |
| } |
| |
| // prebuilt_usr_share is for a prebuilt artifact that is installed in |
| // <partition>/usr/share/<sub_dir> directory. |
| func PrebuiltUserShareFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "usr/share") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| android.InitBazelModule(module) |
| return module |
| } |
| |
| // prebuild_usr_share_host is for a host prebuilt artifact that is installed in |
| // $(HOST_OUT)/usr/share/<sub_dir> directory. |
| func PrebuiltUserShareHostFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "usr/share") |
| // This module is host-only |
| android.InitAndroidArchModule(module, android.HostSupported, android.MultilibCommon) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_font installs a font in <partition>/fonts directory. |
| func PrebuiltFontFactory() android.Module { |
| module := &PrebuiltEtc{} |
| InitPrebuiltEtcModule(module, "fonts") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_firmware installs a firmware file to <partition>/etc/firmware directory for system |
| // image. |
| // If soc_specific property is set to true, the firmware file is installed to the |
| // vendor <partition>/firmware directory for vendor image. |
| func PrebuiltFirmwareFactory() android.Module { |
| module := &PrebuiltEtc{} |
| module.socInstallDirBase = "firmware" |
| InitPrebuiltEtcModule(module, "etc/firmware") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_dsp installs a DSP related file to <partition>/etc/dsp directory for system image. |
| // If soc_specific property is set to true, the DSP related file is installed to the |
| // vendor <partition>/dsp directory for vendor image. |
| func PrebuiltDSPFactory() android.Module { |
| module := &PrebuiltEtc{} |
| module.socInstallDirBase = "dsp" |
| InitPrebuiltEtcModule(module, "etc/dsp") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_renderscript_bitcode installs a *.bc file into /system/lib or /system/lib64. |
| func PrebuiltRenderScriptBitcodeFactory() android.Module { |
| module := &PrebuiltEtc{} |
| module.makeClass = "RENDERSCRIPT_BITCODE" |
| module.installDirBase64 = "lib64" |
| module.installAvoidMultilibConflict = true |
| InitPrebuiltEtcModule(module, "lib") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibBoth) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // prebuilt_rfsa installs a firmware file that will be available through Qualcomm's RFSA |
| // to the <partition>/lib/rfsa directory. |
| func PrebuiltRFSAFactory() android.Module { |
| module := &PrebuiltEtc{} |
| // Ideally these would go in /vendor/dsp, but the /vendor/lib/rfsa paths are hardcoded in too |
| // many places outside of the application processor. They could be moved to /vendor/dsp once |
| // that is cleaned up. |
| InitPrebuiltEtcModule(module, "lib/rfsa") |
| // This module is device-only |
| android.InitAndroidArchModule(module, android.DeviceSupported, android.MultilibFirst) |
| android.InitDefaultableModule(module) |
| return module |
| } |
| |
| // Copy file into the snapshot |
| func copyFile(ctx android.SingletonContext, path android.Path, out string, fake bool) android.OutputPath { |
| if fake { |
| // Create empty file instead for the fake snapshot |
| return snapshot.WriteStringToFileRule(ctx, "", out) |
| } else { |
| return snapshot.CopyFileRule(pctx, ctx, path, out) |
| } |
| } |
| |
| // Check if the module is target of the snapshot |
| func isSnapshotAware(ctx android.SingletonContext, m *PrebuiltEtc, image snapshot.SnapshotImage) bool { |
| if !m.Enabled() { |
| return false |
| } |
| |
| // Skip if the module is not included in the image |
| if !image.InImage(m)() { |
| return false |
| } |
| |
| // When android/prebuilt.go selects between source and prebuilt, it sets |
| // HideFromMake on the other one to avoid duplicate install rules in make. |
| if m.IsHideFromMake() { |
| return false |
| } |
| |
| // There are some prebuilt_etc module with multiple definition of same name. |
| // Check if the target would be included from the build |
| if !m.ExportedToMake() { |
| return false |
| } |
| |
| // Skip if the module is in the predefined path list to skip |
| if image.IsProprietaryPath(ctx.ModuleDir(m), ctx.DeviceConfig()) { |
| return false |
| } |
| |
| // Skip if the module should be excluded |
| if image.ExcludeFromSnapshot(m) || image.ExcludeFromDirectedSnapshot(ctx.DeviceConfig(), m.BaseModuleName()) { |
| return false |
| } |
| |
| // Skip from other exceptional cases |
| if m.Target().Os.Class != android.Device { |
| return false |
| } |
| if m.Target().NativeBridge == android.NativeBridgeEnabled { |
| return false |
| } |
| |
| return true |
| } |
| |
| func generatePrebuiltSnapshot(s snapshot.SnapshotSingleton, ctx android.SingletonContext, snapshotArchDir string) snapshot.SnapshotPaths { |
| /* |
| Snapshot zipped artifacts directory structure for etc modules: |
| {SNAPSHOT_ARCH}/ |
| arch-{TARGET_ARCH}-{TARGET_ARCH_VARIANT}/ |
| etc/ |
| (prebuilt etc files) |
| arch-{TARGET_2ND_ARCH}-{TARGET_2ND_ARCH_VARIANT}/ |
| etc/ |
| (prebuilt etc files) |
| NOTICE_FILES/ |
| (notice files) |
| */ |
| var snapshotOutputs android.Paths |
| var snapshotNotices android.Paths |
| installedNotices := make(map[string]bool) |
| |
| ctx.VisitAllModules(func(module android.Module) { |
| m, ok := module.(*PrebuiltEtc) |
| if !ok { |
| return |
| } |
| |
| if !isSnapshotAware(ctx, m, s.Image) { |
| return |
| } |
| |
| targetArch := "arch-" + m.Target().Arch.ArchType.String() |
| |
| snapshotLibOut := filepath.Join(snapshotArchDir, targetArch, "etc", m.BaseModuleName()) |
| snapshotOutputs = append(snapshotOutputs, copyFile(ctx, m.OutputFile(), snapshotLibOut, s.Fake)) |
| |
| prop := snapshot.SnapshotJsonFlags{} |
| propOut := snapshotLibOut + ".json" |
| prop.InitBaseSnapshotProps(m) |
| prop.RelativeInstallPath = m.SubDir() |
| |
| if m.properties.Filename != nil { |
| prop.Filename = *m.properties.Filename |
| } |
| |
| j, err := json.Marshal(prop) |
| if err != nil { |
| ctx.Errorf("json marshal to %q failed: %#v", propOut, err) |
| return |
| } |
| snapshotOutputs = append(snapshotOutputs, snapshot.WriteStringToFileRule(ctx, string(j), propOut)) |
| |
| for _, notice := range m.EffectiveLicenseFiles() { |
| if _, ok := installedNotices[notice.String()]; !ok { |
| installedNotices[notice.String()] = true |
| snapshotNotices = append(snapshotNotices, notice) |
| } |
| } |
| |
| }) |
| |
| return snapshot.SnapshotPaths{OutputFiles: snapshotOutputs, NoticeFiles: snapshotNotices} |
| } |
| |
| // For Bazel / bp2build |
| |
| type bazelPrebuiltFileAttributes struct { |
| Src bazel.LabelAttribute |
| Filename bazel.LabelAttribute |
| Dir string |
| Installable bazel.BoolAttribute |
| Filename_from_src bazel.BoolAttribute |
| } |
| |
| // Bp2buildHelper returns a bazelPrebuiltFileAttributes used for the conversion |
| // of prebuilt_* modules. bazelPrebuiltFileAttributes has the common attributes |
| // used by both prebuilt_etc_xml and other prebuilt_* moodules |
| func (module *PrebuiltEtc) Bp2buildHelper(ctx android.Bp2buildMutatorContext) (*bazelPrebuiltFileAttributes, bool) { |
| var src bazel.LabelAttribute |
| for axis, configToProps := range module.GetArchVariantProperties(ctx, &prebuiltEtcProperties{}) { |
| for config, p := range configToProps { |
| props, ok := p.(*prebuiltEtcProperties) |
| if !ok { |
| continue |
| } |
| if props.Src != nil { |
| srcStr := proptools.String(props.Src) |
| if srcStr == ctx.ModuleName() { |
| ctx.MarkBp2buildUnconvertible(bp2build_metrics_proto.UnconvertedReasonType_PROPERTY_UNSUPPORTED, "src == name") |
| return &bazelPrebuiltFileAttributes{}, false |
| } |
| label := android.BazelLabelForModuleSrcSingle(ctx, srcStr) |
| src.SetSelectValue(axis, config, label) |
| } |
| } |
| productVarProperties, errs := android.ProductVariableProperties(ctx, ctx.Module()) |
| for _, err := range errs { |
| ctx.ModuleErrorf("ProductVariableProperties error: %s", err) |
| } |
| for propName, productConfigProps := range productVarProperties { |
| for configProp, propVal := range productConfigProps { |
| if propName == "Src" { |
| props, ok := propVal.(*string) |
| if !ok { |
| ctx.PropertyErrorf(" Expected Property to have type string, but was %s\n", reflect.TypeOf(propVal).String()) |
| continue |
| } |
| if props != nil { |
| label := android.BazelLabelForModuleSrcSingle(ctx, *props) |
| src.SetSelectValue(configProp.ConfigurationAxis(), configProp.SelectKey(), label) |
| } |
| } |
| } |
| } |
| } |
| |
| var filename string |
| var filenameFromSrc bool |
| moduleProps := module.properties |
| |
| if moduleProps.Filename != nil && *moduleProps.Filename != "" { |
| filename = *moduleProps.Filename |
| } else if moduleProps.Filename_from_src != nil && *moduleProps.Filename_from_src { |
| if moduleProps.Src != nil { |
| filename = android.BazelLabelForModuleSrcSingle(ctx, *moduleProps.Src).Label |
| } |
| filenameFromSrc = true |
| } else { |
| filename = ctx.ModuleName() |
| } |
| |
| var dir = module.installDirBase |
| if module.SubDir() != "" { |
| dir = dir + "/" + module.SubDir() |
| } |
| |
| var installable bazel.BoolAttribute |
| if install := module.properties.Installable; install != nil { |
| installable.Value = install |
| } |
| |
| attrs := &bazelPrebuiltFileAttributes{ |
| Src: src, |
| Dir: dir, |
| Installable: installable, |
| } |
| |
| if filename != "" { |
| attrs.Filename = bazel.LabelAttribute{Value: &bazel.Label{Label: filename}} |
| } else if filenameFromSrc { |
| attrs.Filename_from_src = bazel.BoolAttribute{Value: moduleProps.Filename_from_src} |
| } |
| |
| return attrs, true |
| } |
| |
| // ConvertWithBp2build performs bp2build conversion of PrebuiltEtc |
| // prebuilt_* modules (except prebuilt_etc_xml) are PrebuiltEtc, |
| // which we treat as *PrebuiltFile* |
| func (module *PrebuiltEtc) ConvertWithBp2build(ctx android.Bp2buildMutatorContext) { |
| var dir = module.installDirBase |
| // prebuilt_file only supports "etc" or "usr/share" or "." as module installDirBase |
| if !(dir == "etc" || dir == "usr/share" || dir == ".") { |
| ctx.MarkBp2buildUnconvertible(bp2build_metrics_proto.UnconvertedReasonType_TYPE_UNSUPPORTED, "dir") |
| return |
| } |
| |
| attrs, convertible := module.Bp2buildHelper(ctx) |
| if !convertible { |
| return |
| } |
| |
| props := bazel.BazelTargetModuleProperties{ |
| Rule_class: "prebuilt_file", |
| Bzl_load_location: "//build/bazel/rules:prebuilt_file.bzl", |
| } |
| |
| ctx.CreateBazelTargetModule(props, android.CommonAttributes{Name: module.Name()}, attrs) |
| } |
| |
| var _ android.MixedBuildBuildable = (*PrebuiltEtc)(nil) |
| |
| func (pe *PrebuiltEtc) IsMixedBuildSupported(ctx android.BaseModuleContext) bool { |
| return true |
| } |
| |
| func (pe *PrebuiltEtc) QueueBazelCall(ctx android.BaseModuleContext) { |
| ctx.Config().BazelContext.QueueBazelRequest( |
| pe.GetBazelLabel(ctx, pe), |
| cquery.GetPrebuiltFileInfo, |
| android.GetConfigKey(ctx), |
| ) |
| } |
| |
| func (pe *PrebuiltEtc) ProcessBazelQueryResponse(ctx android.ModuleContext) { |
| bazelCtx := ctx.Config().BazelContext |
| pfi, err := bazelCtx.GetPrebuiltFileInfo(pe.GetBazelLabel(ctx, pe), android.GetConfigKey(ctx)) |
| if err != nil { |
| ctx.ModuleErrorf(err.Error()) |
| return |
| } |
| |
| // Set properties for androidmk |
| pe.installDirPath = android.PathForModuleInstall(ctx, pfi.Dir) |
| |
| // Installation rules |
| ip := installProperties{ |
| installable: pfi.Installable, |
| filename: pfi.Filename, |
| sourceFilePath: android.PathForSource(ctx, pfi.Src), |
| // symlinks: pe.properties.Symlinks, // TODO: b/207489266 - Fully support all properties in prebuilt_file |
| } |
| pe.addInstallRules(ctx, ip) |
| } |